C10H12BrFO — CID 117369438
1-(3-bromo-2-fluoro-5,6-dimethylphenyl)ethanol (PubChem CID 117369438) has the molecular formula C10H12BrFO and a molecular weight of 247.11 g/mol. Its IUPAC name is 1-(3-bromo-2-fluoro-5,6-dimethylphenyl)ethanol.
| Compound Name | 1-(3-bromo-2-fluoro-5,6-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 117369438 |
| Molecular Formula | C10H12BrFO |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 246.01 |
| IUPAC Name | 1-(3-bromo-2-fluoro-5,6-dimethylphenyl)ethanol |
| SMILES | Cc1cc(Br)c(F)c(C(C)O)c1C |
| InChI | InChI=1S/C10H12BrFO/c1-5-4-8(11)10(12)9(6(5)2)7(3)13/h4,7,13H,1-3H3 |
| InChIKey | KBDCHBHLYLWYIS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |