C15H13Cl2FO — CID 106879443
(2,6-dichlorophenyl)-(4-fluoro-2,6-dimethylphenyl)methanol (PubChem CID 106879443) has the molecular formula C15H13Cl2FO and a molecular weight of 299.17 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(4-fluoro-2,6-dimethylphenyl)methanol.
| Compound Name | (2,6-dichlorophenyl)-(4-fluoro-2,6-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 106879443 |
| Molecular Formula | C15H13Cl2FO |
| Molecular Weight | 299.17 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | (2,6-dichlorophenyl)-(4-fluoro-2,6-dimethylphenyl)methanol |
| SMILES | Cc1cc(F)cc(C)c1C(O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H13Cl2FO/c1-8-6-10(18)7-9(2)13(8)15(19)14-11(16)4-3-5-12(14)17/h3-7,15,19H,1-2H3 |
| InChIKey | VVMOXDAXRWWGJE-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.17 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |