C13H5Cl2F5O — CID 45103212
(2,6-dichlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol (PubChem CID 45103212) has the molecular formula C13H5Cl2F5O and a molecular weight of 343.08 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol.
| Compound Name | (2,6-dichlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol |
|---|---|
| PubChem CID | 45103212 |
| Molecular Formula | C13H5Cl2F5O |
| Molecular Weight | 343.08 g/mol |
| Exact Mass | 341.96 |
| IUPAC Name | (2,6-dichlorophenyl)-(2,3,4,5,6-pentafluorophenyl)methanol |
| SMILES | OC(c1c(Cl)cccc1Cl)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H5Cl2F5O/c14-4-2-1-3-5(15)6(4)13(21)7-8(16)10(18)12(20)11(19)9(7)17/h1-3,13,21H |
| InChIKey | FRHWRZXXPFMOCK-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.08 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|