C13H8Cl3FO — CID 61271392
(2-chloro-6-fluorophenyl)-(2,4-dichlorophenyl)methanol (PubChem CID 61271392) has the molecular formula C13H8Cl3FO and a molecular weight of 305.56 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)-(2,4-dichlorophenyl)methanol.
| Compound Name | (2-chloro-6-fluorophenyl)-(2,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 61271392 |
| Molecular Formula | C13H8Cl3FO |
| Molecular Weight | 305.56 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | (2-chloro-6-fluorophenyl)-(2,4-dichlorophenyl)methanol |
| SMILES | OC(c1ccc(Cl)cc1Cl)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H8Cl3FO/c14-7-4-5-8(10(16)6-7)13(18)12-9(15)2-1-3-11(12)17/h1-6,13,18H |
| InChIKey | URFFKAPISWKRQX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |