C13H10Cl3NO — CID 129389407
(S)-(2-amino-5-chlorophenyl)-(2,6-dichlorophenyl)methanol (PubChem CID 129389407) has the molecular formula C13H10Cl3NO and a molecular weight of 302.59 g/mol. Its IUPAC name is (S)-(2-amino-5-chlorophenyl)-(2,6-dichlorophenyl)methanol.
| Compound Name | (S)-(2-amino-5-chlorophenyl)-(2,6-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 129389407 |
| Molecular Formula | C13H10Cl3NO |
| Molecular Weight | 302.59 g/mol |
| Exact Mass | 300.98 |
| IUPAC Name | (S)-(2-amino-5-chlorophenyl)-(2,6-dichlorophenyl)methanol |
| SMILES | Nc1ccc(Cl)cc1[C@H](O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C13H10Cl3NO/c14-7-4-5-11(17)8(6-7)13(18)12-9(15)2-1-3-10(12)16/h1-6,13,18H,17H2/t13-/m0/s1 |
| InChIKey | LLRJOLPDSYQQNJ-ZDUSSCGKSA-N |
| XLogP | 4.31 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.59 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|