C9H9ClN2O2 — CID 171869930
3-(2-amino-5-chlorophenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171869930) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 3-(2-amino-5-chlorophenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(2-amino-5-chlorophenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171869930 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 3-(2-amino-5-chlorophenyl)-2,3-dihydroxypropanenitrile |
| SMILES | N#CC(O)C(O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C9H9ClN2O2/c10-5-1-2-7(12)6(3-5)9(14)8(13)4-11/h1-3,8-9,13-14H,12H2 |
| InChIKey | MNXWYAWSDAIDIF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|