C10H10ClNO3 — CID 171870123
3-(4-chloro-2-methoxyphenyl)-2,3-dihydroxypropanenitrile (PubChem CID 171870123) has the molecular formula C10H10ClNO3 and a molecular weight of 227.65 g/mol. Its IUPAC name is 3-(4-chloro-2-methoxyphenyl)-2,3-dihydroxypropanenitrile.
| Compound Name | 3-(4-chloro-2-methoxyphenyl)-2,3-dihydroxypropanenitrile |
|---|---|
| PubChem CID | 171870123 |
| Molecular Formula | C10H10ClNO3 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 3-(4-chloro-2-methoxyphenyl)-2,3-dihydroxypropanenitrile |
| SMILES | COc1cc(Cl)ccc1C(O)C(O)C#N |
| InChI | InChI=1S/C10H10ClNO3/c1-15-9-4-6(11)2-3-7(9)10(14)8(13)5-12/h2-4,8,10,13-14H,1H3 |
| InChIKey | XKBCQINYECGTDZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|