C14H10Cl2F2O — CID 82816626
(2,4-dichlorophenyl)-(2,6-difluoro-3-methylphenyl)methanol (PubChem CID 82816626) has the molecular formula C14H10Cl2F2O and a molecular weight of 303.14 g/mol. Its IUPAC name is (2,4-dichlorophenyl)-(2,6-difluoro-3-methylphenyl)methanol.
| Compound Name | (2,4-dichlorophenyl)-(2,6-difluoro-3-methylphenyl)methanol |
|---|---|
| PubChem CID | 82816626 |
| Molecular Formula | C14H10Cl2F2O |
| Molecular Weight | 303.14 g/mol |
| Exact Mass | 302.01 |
| IUPAC Name | (2,4-dichlorophenyl)-(2,6-difluoro-3-methylphenyl)methanol |
| SMILES | Cc1ccc(F)c(C(O)c2ccc(Cl)cc2Cl)c1F |
| InChI | InChI=1S/C14H10Cl2F2O/c1-7-2-5-11(17)12(13(7)18)14(19)9-4-3-8(15)6-10(9)16/h2-6,14,19H,1H3 |
| InChIKey | BLLDKHGVINYIJU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.14 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |