C8H5ClF4O — CID 130512088
(1R)-1-(2-chloro-6-fluorophenyl)-2,2,2-trifluoroethanol (PubChem CID 130512088) has the molecular formula C8H5ClF4O and a molecular weight of 228.57 g/mol. Its IUPAC name is (1R)-1-(2-chloro-6-fluorophenyl)-2,2,2-trifluoroethanol.
| Compound Name | (1R)-1-(2-chloro-6-fluorophenyl)-2,2,2-trifluoroethanol |
|---|---|
| PubChem CID | 130512088 |
| Molecular Formula | C8H5ClF4O |
| Molecular Weight | 228.57 g/mol |
| Exact Mass | 228.00 |
| IUPAC Name | (1R)-1-(2-chloro-6-fluorophenyl)-2,2,2-trifluoroethanol |
| SMILES | O[C@H](c1c(F)cccc1Cl)C(F)(F)F |
| InChI | InChI=1S/C8H5ClF4O/c9-4-2-1-3-5(10)6(4)7(14)8(11,12)13/h1-3,7,14H/t7-/m1/s1 |
| InChIKey | HAFNMYQVKGJDSZ-SSDOTTSWSA-N |
| XLogP | 3.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.57 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |