C15H24FN — CID 106878041
N-ethyl-1-(4-fluoro-2,6-dimethylphenyl)pentan-1-amine (PubChem CID 106878041) has the molecular formula C15H24FN and a molecular weight of 237.36 g/mol. Its IUPAC name is N-ethyl-1-(4-fluoro-2,6-dimethylphenyl)pentan-1-amine.
| Compound Name | N-ethyl-1-(4-fluoro-2,6-dimethylphenyl)pentan-1-amine |
|---|---|
| PubChem CID | 106878041 |
| Molecular Formula | C15H24FN |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.19 |
| IUPAC Name | N-ethyl-1-(4-fluoro-2,6-dimethylphenyl)pentan-1-amine |
| SMILES | CCCCC(NCC)c1c(C)cc(F)cc1C |
| InChI | InChI=1S/C15H24FN/c1-5-7-8-14(17-6-2)15-11(3)9-13(16)10-12(15)4/h9-10,14,17H,5-8H2,1-4H3 |
| InChIKey | JNUBOVHTHKQMJT-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |