C17H29N — CID 43491113
N-ethyl-1-(2,4,6-trimethylphenyl)hexan-1-amine (PubChem CID 43491113) has the molecular formula C17H29N and a molecular weight of 247.43 g/mol. Its IUPAC name is N-ethyl-1-(2,4,6-trimethylphenyl)hexan-1-amine.
| Compound Name | N-ethyl-1-(2,4,6-trimethylphenyl)hexan-1-amine |
|---|---|
| PubChem CID | 43491113 |
| Molecular Formula | C17H29N |
| Molecular Weight | 247.43 g/mol |
| Exact Mass | 247.23 |
| IUPAC Name | N-ethyl-1-(2,4,6-trimethylphenyl)hexan-1-amine |
| SMILES | CCCCCC(NCC)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H29N/c1-6-8-9-10-16(18-7-2)17-14(4)11-13(3)12-15(17)5/h11-12,16,18H,6-10H2,1-5H3 |
| InChIKey | IFPJRXPHKFSFJL-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|