C15H25FN2 — CID 106884598
1-(2-fluoro-4,6-dimethylphenyl)heptylhydrazine (PubChem CID 106884598) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)heptylhydrazine.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)heptylhydrazine |
|---|---|
| PubChem CID | 106884598 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)heptylhydrazine |
| SMILES | CCCCCCC(NN)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C15H25FN2/c1-4-5-6-7-8-14(18-17)15-12(3)9-11(2)10-13(15)16/h9-10,14,18H,4-8,17H2,1-3H3 |
| InChIKey | HBLYXEKRDRKUBF-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|