C18H23FN2 — CID 106884529
[1-(2-fluoro-4,6-dimethylphenyl)-3-(2-methylphenyl)propyl]hydrazine (PubChem CID 106884529) has the molecular formula C18H23FN2 and a molecular weight of 286.39 g/mol. Its IUPAC name is [1-(2-fluoro-4,6-dimethylphenyl)-3-(2-methylphenyl)propyl]hydrazine.
| Compound Name | [1-(2-fluoro-4,6-dimethylphenyl)-3-(2-methylphenyl)propyl]hydrazine |
|---|---|
| PubChem CID | 106884529 |
| Molecular Formula | C18H23FN2 |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [1-(2-fluoro-4,6-dimethylphenyl)-3-(2-methylphenyl)propyl]hydrazine |
| SMILES | Cc1cc(C)c(C(CCc2ccccc2C)NN)c(F)c1 |
| InChI | InChI=1S/C18H23FN2/c1-12-10-14(3)18(16(19)11-12)17(21-20)9-8-15-7-5-4-6-13(15)2/h4-7,10-11,17,21H,8-9,20H2,1-3H3 |
| InChIKey | IWPVLYBIDJWQHT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|