C12H16F4N2O — CID 106884466
[1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine (PubChem CID 106884466) has the molecular formula C12H16F4N2O and a molecular weight of 280.27 g/mol. Its IUPAC name is [1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine.
| Compound Name | [1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
|---|---|
| PubChem CID | 106884466 |
| Molecular Formula | C12H16F4N2O |
| Molecular Weight | 280.27 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | [1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,2-trifluoroethoxy)ethyl]hydrazine |
| SMILES | Cc1cc(C)c(C(COCC(F)(F)F)NN)c(F)c1 |
| InChI | InChI=1S/C12H16F4N2O/c1-7-3-8(2)11(9(13)4-7)10(18-17)5-19-6-12(14,15)16/h3-4,10,18H,5-6,17H2,1-2H3 |
| InChIKey | DWCPYRSXCQURQU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|