C13H15F5O2 — CID 106881222
1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol (PubChem CID 106881222) has the molecular formula C13H15F5O2 and a molecular weight of 298.25 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
|---|---|
| PubChem CID | 106881222 |
| Molecular Formula | C13H15F5O2 |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-(2,2,3,3-tetrafluoropropoxy)ethanol |
| SMILES | Cc1cc(C)c(C(O)COCC(F)(F)C(F)F)c(F)c1 |
| InChI | InChI=1S/C13H15F5O2/c1-7-3-8(2)11(9(14)4-7)10(19)5-20-6-13(17,18)12(15)16/h3-4,10,12,19H,5-6H2,1-2H3 |
| InChIKey | GOIVWIVLMDDGSP-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|