C13H19FO2 — CID 106881025
1-(2-fluoro-4,6-dimethylphenyl)-2-propoxyethanol (PubChem CID 106881025) has the molecular formula C13H19FO2 and a molecular weight of 226.29 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-2-propoxyethanol.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-propoxyethanol |
|---|---|
| PubChem CID | 106881025 |
| Molecular Formula | C13H19FO2 |
| Molecular Weight | 226.29 g/mol |
| Exact Mass | 226.14 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-propoxyethanol |
| SMILES | CCCOCC(O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C13H19FO2/c1-4-5-16-8-12(15)13-10(3)6-9(2)7-11(13)14/h6-7,12,15H,4-5,8H2,1-3H3 |
| InChIKey | BPXSIBCYWPPDFD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|