C17H19FO2 — CID 106881014
1-(2-fluoro-4,6-dimethylphenyl)-2-(4-methoxyphenyl)ethanol (PubChem CID 106881014) has the molecular formula C17H19FO2 and a molecular weight of 274.34 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-2-(4-methoxyphenyl)ethanol.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-(4-methoxyphenyl)ethanol |
|---|---|
| PubChem CID | 106881014 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-2-(4-methoxyphenyl)ethanol |
| SMILES | COc1ccc(CC(O)c2c(C)cc(C)cc2F)cc1 |
| InChI | InChI=1S/C17H19FO2/c1-11-8-12(2)17(15(18)9-11)16(19)10-13-4-6-14(20-3)7-5-13/h4-9,16,19H,10H2,1-3H3 |
| InChIKey | PDRHWTFYYUISKN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |