C14H21FO2 — CID 106884071
1-(2-fluoro-4,6-dimethylphenyl)-4-methoxypentan-1-ol (PubChem CID 106884071) has the molecular formula C14H21FO2 and a molecular weight of 240.32 g/mol. Its IUPAC name is 1-(2-fluoro-4,6-dimethylphenyl)-4-methoxypentan-1-ol.
| Compound Name | 1-(2-fluoro-4,6-dimethylphenyl)-4-methoxypentan-1-ol |
|---|---|
| PubChem CID | 106884071 |
| Molecular Formula | C14H21FO2 |
| Molecular Weight | 240.32 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 1-(2-fluoro-4,6-dimethylphenyl)-4-methoxypentan-1-ol |
| SMILES | COC(C)CCC(O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C14H21FO2/c1-9-7-10(2)14(12(15)8-9)13(16)6-5-11(3)17-4/h7-8,11,13,16H,5-6H2,1-4H3 |
| InChIKey | LMZVAVNNSBIXHB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.32 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |