C13H15FO2 — CID 58964845
3-(2-fluoro-4,6-dimethylphenyl)pentane-2,4-dione (PubChem CID 58964845) has the molecular formula C13H15FO2 and a molecular weight of 222.26 g/mol. Its IUPAC name is 3-(2-fluoro-4,6-dimethylphenyl)pentane-2,4-dione.
| Compound Name | 3-(2-fluoro-4,6-dimethylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 58964845 |
| Molecular Formula | C13H15FO2 |
| Molecular Weight | 222.26 g/mol |
| Exact Mass | 222.11 |
| IUPAC Name | 3-(2-fluoro-4,6-dimethylphenyl)pentane-2,4-dione |
| SMILES | CC(=O)C(C(C)=O)c1c(C)cc(C)cc1F |
| InChI | InChI=1S/C13H15FO2/c1-7-5-8(2)12(11(14)6-7)13(9(3)15)10(4)16/h5-6,13H,1-4H3 |
| InChIKey | HCSVHEIBGIUVSG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|