C12H12BaO4 — CID 153423889
barium(2+);2-(2,4,6-trimethylphenyl)propanedioate (PubChem CID 153423889) has the molecular formula C12H12BaO4 and a molecular weight of 357.55 g/mol. Its IUPAC name is barium(2+);2-(2,4,6-trimethylphenyl)propanedioate.
| Compound Name | barium(2+);2-(2,4,6-trimethylphenyl)propanedioate |
|---|---|
| PubChem CID | 153423889 |
| Molecular Formula | C12H12BaO4 |
| Molecular Weight | 357.55 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | barium(2+);2-(2,4,6-trimethylphenyl)propanedioate |
| SMILES | Cc1cc(C)c(C(C(=O)[O-])C(=O)[O-])c(C)c1.[Ba+2] |
| InChI | InChI=1S/C12H14O4.Ba/c1-6-4-7(2)9(8(3)5-6)10(11(13)14)12(15)16;/h4-5,10H,1-3H3,(H,13,14)(H,15,16);/q;+2/p-2 |
| InChIKey | ZMROIBUYKJEFEG-UHFFFAOYSA-L |
| XLogP | -1.19 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.55 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|