C17H17O2- — CID 78425392
2-phenyl-2-(2,4,6-trimethylphenyl)acetate (PubChem CID 78425392) has the molecular formula C17H17O2- and a molecular weight of 253.32 g/mol. Its IUPAC name is 2-phenyl-2-(2,4,6-trimethylphenyl)acetate.
| Compound Name | 2-phenyl-2-(2,4,6-trimethylphenyl)acetate |
|---|---|
| PubChem CID | 78425392 |
| Molecular Formula | C17H17O2- |
| Molecular Weight | 253.32 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 2-phenyl-2-(2,4,6-trimethylphenyl)acetate |
| SMILES | Cc1cc(C)c(C(C(=O)[O-])c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C17H18O2/c1-11-9-12(2)15(13(3)10-11)16(17(18)19)14-7-5-4-6-8-14/h4-10,16H,1-3H3,(H,18,19)/p-1 |
| InChIKey | RYZVPLVIQGWEIJ-UHFFFAOYSA-M |
| XLogP | 2.49 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.32 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |