C14H13ClO2 — CID 162326731
chloranium 2,2-diphenylacetate (PubChem CID 162326731) has the molecular formula C14H13ClO2 and a molecular weight of 248.71 g/mol. Its IUPAC name is chloranium 2,2-diphenylacetate.
| Compound Name | chloranium 2,2-diphenylacetate |
|---|---|
| PubChem CID | 162326731 |
| Molecular Formula | C14H13ClO2 |
| Molecular Weight | 248.71 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | chloranium 2,2-diphenylacetate |
| SMILES | O=C([O-])C(c1ccccc1)c1ccccc1.[ClH2+] |
| InChI | InChI=1S/C14H12O2.ClH2/c15-14(16)13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h1-10,13H,(H,15,16);1H2/q;+1/p-1 |
| InChIKey | WTNJECGEOMHTQT-UHFFFAOYSA-M |
| XLogP | 1.03 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.71 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |