About azanium 2-phenylpropanoate
azanium 2-phenylpropanoate (PubChem CID 146635852) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is azanium 2-phenylpropanoate.
Molecular Properties
| Compound Name | azanium 2-phenylpropanoate |
| PubChem CID | 146635852 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | azanium 2-phenylpropanoate |
| SMILES | CC(C(=O)[O-])c1ccccc1.[NH4+] |
| InChI | InChI=1S/C9H10O2.H3N/c1-7(9(10)11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,10,11);1H3 |
| InChIKey | WXXHUAXDYFYSTJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 76.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanium 2-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium 2-phenylpropanoate?
The IUPAC name of azanium 2-phenylpropanoate (CID 146635852) is azanium 2-phenylpropanoate.
What is the SMILES notation for azanium 2-phenylpropanoate?
The canonical SMILES for azanium 2-phenylpropanoate is CC(C(=O)[O-])c1ccccc1.[NH4+].
What is the InChIKey of azanium 2-phenylpropanoate?
The InChIKey is WXXHUAXDYFYSTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.H3N/c1-7(9(10)11)8-5-3-2-4-6-8;/h2-7H,1H3,(H,10,11);1H3.
What are the key properties of azanium 2-phenylpropanoate?
azanium 2-phenylpropanoate has a molecular weight of 167.21 g/mol, XLogP of 0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanium 2-phenylpropanoate is sourced from PubChem (CID 146635852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).