About disodium;2-(4-oxidophenyl)propanoate
disodium;2-(4-oxidophenyl)propanoate (PubChem CID 171474664) has the molecular formula C9H8Na2O3
and a molecular weight of 210.14 g/mol. Its IUPAC name is disodium;2-(4-oxidophenyl)propanoate.
Molecular Properties
| Compound Name | disodium;2-(4-oxidophenyl)propanoate |
| PubChem CID | 171474664 |
| Molecular Formula | C9H8Na2O3 |
| Molecular Weight | 210.14 g/mol |
| Exact Mass | 210.03 |
| IUPAC Name | disodium;2-(4-oxidophenyl)propanoate |
| SMILES | CC(C(=O)[O-])c1ccc([O-])cc1.[Na+].[Na+] |
| InChI | InChI=1S/C9H10O3.2Na/c1-6(9(11)12)7-2-4-8(10)5-3-7;;/h2-6,10H,1H3,(H,11,12);;/q;2*+1/p-2 |
| InChIKey | WFOBBCBZBKCTJI-UHFFFAOYSA-L |
| XLogP | -6.38 |
| TPSA | 63.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.14 |
| LogP ≤ 5 | -6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze disodium;2-(4-oxidophenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-(4-oxidophenyl)propanoate?
The IUPAC name of disodium;2-(4-oxidophenyl)propanoate (CID 171474664) is disodium;2-(4-oxidophenyl)propanoate.
What is the SMILES notation for disodium;2-(4-oxidophenyl)propanoate?
The canonical SMILES for disodium;2-(4-oxidophenyl)propanoate is CC(C(=O)[O-])c1ccc([O-])cc1.[Na+].[Na+].
What is the InChIKey of disodium;2-(4-oxidophenyl)propanoate?
The InChIKey is WFOBBCBZBKCTJI-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H10O3.2Na/c1-6(9(11)12)7-2-4-8(10)5-3-7;;/h2-6,10H,1H3,(H,11,12);;/q;2*+1/p-2.
What are the key properties of disodium;2-(4-oxidophenyl)propanoate?
disodium;2-(4-oxidophenyl)propanoate has a molecular weight of 210.14 g/mol, XLogP of -6.38, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-(4-oxidophenyl)propanoate is sourced from PubChem (CID 171474664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).