C21H25O4- — CID 22761104
2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]propanoate (PubChem CID 22761104) has the molecular formula C21H25O4- and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]propanoate.
| Compound Name | 2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]propanoate |
|---|---|
| PubChem CID | 22761104 |
| Molecular Formula | C21H25O4- |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 2-[4-[2-(4-tert-butylphenoxy)ethoxy]phenyl]propanoate |
| SMILES | CC(C(=O)[O-])c1ccc(OCCOc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H26O4/c1-15(20(22)23)16-5-9-18(10-6-16)24-13-14-25-19-11-7-17(8-12-19)21(2,3)4/h5-12,15H,13-14H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | ACINTPZJVBIJRF-UHFFFAOYSA-M |
| XLogP | 3.30 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|