About (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate
(4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate (PubChem CID 35292720) has the molecular formula C19H24O5S
and a molecular weight of 364.46 g/mol. Its IUPAC name is (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate.
Molecular Properties
| Compound Name | (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate |
| PubChem CID | 35292720 |
| Molecular Formula | C19H24O5S |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate |
| SMILES | COCCOc1ccc(S(=O)(=O)Oc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24O5S/c1-19(2,3)15-5-7-17(8-6-15)24-25(20,21)18-11-9-16(10-12-18)23-14-13-22-4/h5-12H,13-14H2,1-4H3 |
| InChIKey | RIGORGGJPSBTFD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate?
The IUPAC name of (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate (CID 35292720) is (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate.
What is the SMILES notation for (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate?
The canonical SMILES for (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate is COCCOc1ccc(S(=O)(=O)Oc2ccc(C(C)(C)C)cc2)cc1.
What is the InChIKey of (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate?
The InChIKey is RIGORGGJPSBTFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24O5S/c1-19(2,3)15-5-7-17(8-6-15)24-25(20,21)18-11-9-16(10-12-18)23-14-13-22-4/h5-12H,13-14H2,1-4H3.
What are the key properties of (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate?
(4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate has a molecular weight of 364.46 g/mol, XLogP of 3.78, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tert-butylphenyl) 4-(2-methoxyethoxy)benzenesulfonate is sourced from PubChem (CID 35292720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).