C16H14O9S — CID 139738775
2-[4-[4-(carboxymethoxy)phenyl]sulfonyloxyphenoxy]acetic acid (PubChem CID 139738775) has the molecular formula C16H14O9S and a molecular weight of 382.35 g/mol. Its IUPAC name is 2-[4-[4-(carboxymethoxy)phenyl]sulfonyloxyphenoxy]acetic acid.
| Compound Name | 2-[4-[4-(carboxymethoxy)phenyl]sulfonyloxyphenoxy]acetic acid |
|---|---|
| PubChem CID | 139738775 |
| Molecular Formula | C16H14O9S |
| Molecular Weight | 382.35 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 2-[4-[4-(carboxymethoxy)phenyl]sulfonyloxyphenoxy]acetic acid |
| SMILES | O=C(O)COc1ccc(OS(=O)(=O)c2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C16H14O9S/c17-15(18)9-23-11-1-3-13(4-2-11)25-26(21,22)14-7-5-12(6-8-14)24-10-16(19)20/h1-8H,9-10H2,(H,17,18)(H,19,20) |
| InChIKey | LHUOVKYSCLPDHT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.35 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|