About (4-phenylmethoxyphenyl) benzenesulfonate
(4-phenylmethoxyphenyl) benzenesulfonate (PubChem CID 7227856) has the molecular formula C19H16O4S
and a molecular weight of 340.40 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) benzenesulfonate.
Molecular Properties
| Compound Name | (4-phenylmethoxyphenyl) benzenesulfonate |
| PubChem CID | 7227856 |
| Molecular Formula | C19H16O4S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | (4-phenylmethoxyphenyl) benzenesulfonate |
| SMILES | O=S(=O)(Oc1ccc(OCc2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C19H16O4S/c20-24(21,19-9-5-2-6-10-19)23-18-13-11-17(12-14-18)22-15-16-7-3-1-4-8-16/h1-14H,15H2 |
| InChIKey | RGJFNLCJMKVAGX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-phenylmethoxyphenyl) benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylmethoxyphenyl) benzenesulfonate?
The IUPAC name of (4-phenylmethoxyphenyl) benzenesulfonate (CID 7227856) is (4-phenylmethoxyphenyl) benzenesulfonate.
What is the SMILES notation for (4-phenylmethoxyphenyl) benzenesulfonate?
The canonical SMILES for (4-phenylmethoxyphenyl) benzenesulfonate is O=S(=O)(Oc1ccc(OCc2ccccc2)cc1)c1ccccc1.
What is the InChIKey of (4-phenylmethoxyphenyl) benzenesulfonate?
The InChIKey is RGJFNLCJMKVAGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16O4S/c20-24(21,19-9-5-2-6-10-19)23-18-13-11-17(12-14-18)22-15-16-7-3-1-4-8-16/h1-14H,15H2.
What are the key properties of (4-phenylmethoxyphenyl) benzenesulfonate?
(4-phenylmethoxyphenyl) benzenesulfonate has a molecular weight of 340.40 g/mol, XLogP of 4.03, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylmethoxyphenyl) benzenesulfonate is sourced from PubChem (CID 7227856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).