C23H24O4S — CID 87298411
[4-(2-phenylmethoxybutan-2-yl)phenyl] benzenesulfonate (PubChem CID 87298411) has the molecular formula C23H24O4S and a molecular weight of 396.51 g/mol. Its IUPAC name is [4-(2-phenylmethoxybutan-2-yl)phenyl] benzenesulfonate.
| Compound Name | [4-(2-phenylmethoxybutan-2-yl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 87298411 |
| Molecular Formula | C23H24O4S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | [4-(2-phenylmethoxybutan-2-yl)phenyl] benzenesulfonate |
| SMILES | CCC(C)(OCc1ccccc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H24O4S/c1-3-23(2,26-18-19-10-6-4-7-11-19)20-14-16-21(17-15-20)27-28(24,25)22-12-8-5-9-13-22/h4-17H,3,18H2,1-2H3 |
| InChIKey | QKLSTDFQLGSXFJ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|