C24H23NO7S — CID 87297605
1-O-benzyl 4-O-methyl 2-amino-2-[4-(benzenesulfonyloxy)phenyl]butanedioate (PubChem CID 87297605) has the molecular formula C24H23NO7S and a molecular weight of 469.52 g/mol. Its IUPAC name is 1-O-benzyl 4-O-methyl 2-amino-2-[4-(benzenesulfonyloxy)phenyl]butanedioate.
| Compound Name | 1-O-benzyl 4-O-methyl 2-amino-2-[4-(benzenesulfonyloxy)phenyl]butanedioate |
|---|---|
| PubChem CID | 87297605 |
| Molecular Formula | C24H23NO7S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | 1-O-benzyl 4-O-methyl 2-amino-2-[4-(benzenesulfonyloxy)phenyl]butanedioate |
| SMILES | COC(=O)CC(N)(C(=O)OCc1ccccc1)c1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H23NO7S/c1-30-22(26)16-24(25,23(27)31-17-18-8-4-2-5-9-18)19-12-14-20(15-13-19)32-33(28,29)21-10-6-3-7-11-21/h2-15H,16-17,25H2,1H3 |
| InChIKey | OEFNIZMIKUXOEF-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 121.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|