C31H29NO7S — CID 87541703
benzyl 2-[[4-(benzenesulfonyloxy)phenyl]methyl]-3-(phenylmethoxycarbonylamino)propanoate (PubChem CID 87541703) has the molecular formula C31H29NO7S and a molecular weight of 559.64 g/mol. Its IUPAC name is benzyl 2-[[4-(benzenesulfonyloxy)phenyl]methyl]-3-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl 2-[[4-(benzenesulfonyloxy)phenyl]methyl]-3-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 87541703 |
| Molecular Formula | C31H29NO7S |
| Molecular Weight | 559.64 g/mol |
| Exact Mass | 559.17 |
| IUPAC Name | benzyl 2-[[4-(benzenesulfonyloxy)phenyl]methyl]-3-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(NCC(Cc1ccc(OS(=O)(=O)c2ccccc2)cc1)C(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C31H29NO7S/c33-30(37-22-25-10-4-1-5-11-25)27(21-32-31(34)38-23-26-12-6-2-7-13-26)20-24-16-18-28(19-17-24)39-40(35,36)29-14-8-3-9-15-29/h1-19,27H,20-23H2,(H,32,34) |
| InChIKey | PEKNTUVUANEVRU-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.64 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|