About [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate
[4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate (PubChem CID 3441107) has the molecular formula C28H24N2O10S2
and a molecular weight of 612.64 g/mol. Its IUPAC name is [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate |
| PubChem CID | 3441107 |
| Molecular Formula | C28H24N2O10S2 |
| Molecular Weight | 612.64 g/mol |
| Exact Mass | 612.09 |
| IUPAC Name | [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate |
| SMILES | CCC(C)(c1ccc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)c1ccc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C28H24N2O10S2/c1-3-28(2,20-4-12-24(13-5-20)39-41(35,36)26-16-8-22(9-17-26)29(31)32)21-6-14-25(15-7-21)40-42(37,38)27-18-10-23(11-19-27)30(33)34/h4-19H,3H2,1-2H3 |
| InChIKey | BKPKZZRWIBMUKW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 173.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 612.64 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate?
The IUPAC name of [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate (CID 3441107) is [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate.
What is the SMILES notation for [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate?
The canonical SMILES for [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate is CCC(C)(c1ccc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1)c1ccc(OS(=O)(=O)c2ccc([N+](=O)[O-])cc2)cc1.
What is the InChIKey of [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate?
The InChIKey is BKPKZZRWIBMUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H24N2O10S2/c1-3-28(2,20-4-12-24(13-5-20)39-41(35,36)26-16-8-22(9-17-26)29(31)32)21-6-14-25(15-7-21)40-42(37,38)27-18-10-23(11-19-27)30(33)34/h4-19H,3H2,1-2H3.
What are the key properties of [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate?
[4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate has a molecular weight of 612.64 g/mol, XLogP of 5.75, 11 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[4-(4-nitrophenyl)sulfonyloxyphenyl]butan-2-yl]phenyl] 4-nitrobenzenesulfonate is sourced from PubChem (CID 3441107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).