C28H23F2NO5S — CID 5224123
[4-[[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5224123) has the molecular formula C28H23F2NO5S and a molecular weight of 523.56 g/mol. Its IUPAC name is [4-[[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5224123 |
| Molecular Formula | C28H23F2NO5S |
| Molecular Weight | 523.56 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | [4-[[(4-fluorophenyl)methyl-(2-phenoxyacetyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | O=C(COc1ccccc1)N(Cc1ccc(F)cc1)Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C28H23F2NO5S/c29-23-10-6-21(7-11-23)18-31(28(32)20-35-25-4-2-1-3-5-25)19-22-8-14-26(15-9-22)36-37(33,34)27-16-12-24(30)13-17-27/h1-17H,18-20H2 |
| InChIKey | MTELDLUHOLOWFL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.56 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|