C26H26FNO4S — CID 5180530
[4-[[2-methylpropyl(3-phenylprop-2-enoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5180530) has the molecular formula C26H26FNO4S and a molecular weight of 467.56 g/mol. Its IUPAC name is [4-[[2-methylpropyl(3-phenylprop-2-enoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[2-methylpropyl(3-phenylprop-2-enoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5180530 |
| Molecular Formula | C26H26FNO4S |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [4-[[2-methylpropyl(3-phenylprop-2-enoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C26H26FNO4S/c1-20(2)18-28(26(29)17-10-21-6-4-3-5-7-21)19-22-8-13-24(14-9-22)32-33(30,31)25-15-11-23(27)12-16-25/h3-17,20H,18-19H2,1-2H3 |
| InChIKey | ZNWGMPXUSFGHPX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|