C27H25F3N2O6S — CID 3477358
[4-[[2-methylpropyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 3477358) has the molecular formula C27H25F3N2O6S and a molecular weight of 562.57 g/mol. Its IUPAC name is [4-[[2-methylpropyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[2-methylpropyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 3477358 |
| Molecular Formula | C27H25F3N2O6S |
| Molecular Weight | 562.57 g/mol |
| Exact Mass | 562.14 |
| IUPAC Name | [4-[[2-methylpropyl-[3-(4-nitrophenyl)prop-2-enoyl]amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)C(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C27H25F3N2O6S/c1-19(2)17-31(26(33)15-10-20-6-11-23(12-7-20)32(34)35)18-21-8-13-24(14-9-21)38-39(36,37)25-5-3-4-22(16-25)27(28,29)30/h3-16,19H,17-18H2,1-2H3 |
| InChIKey | IKYYFGDVGQLPHE-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|