C28H26F3NO5S2 — CID 4648139
[4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate (PubChem CID 4648139) has the molecular formula C28H26F3NO5S2 and a molecular weight of 577.65 g/mol. Its IUPAC name is [4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate.
| Compound Name | [4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 4648139 |
| Molecular Formula | C28H26F3NO5S2 |
| Molecular Weight | 577.65 g/mol |
| Exact Mass | 577.12 |
| IUPAC Name | [4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] 3-(trifluoromethyl)benzenesulfonate |
| SMILES | CC(C)CN(Cc1ccc(OS(=O)(=O)c2cccc(C(F)(F)F)c2)cc1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H26F3NO5S2/c1-20(2)18-32(38(33,34)26-15-12-22-6-3-4-7-23(22)16-26)19-21-10-13-25(14-11-21)37-39(35,36)27-9-5-8-24(17-27)28(29,30)31/h3-17,20H,18-19H2,1-2H3 |
| InChIKey | VXOPMKNLFMALLA-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.65 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|