C23H27NO5S2 — CID 3906908
[4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 3906908) has the molecular formula C23H27NO5S2 and a molecular weight of 461.61 g/mol. Its IUPAC name is [4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3906908 |
| Molecular Formula | C23H27NO5S2 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | [4-[[2-methylpropyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CN(CC(C)C)S(=O)(=O)c2ccc3ccccc3c2)cc1 |
| InChI | InChI=1S/C23H27NO5S2/c1-4-30(25,26)29-22-12-9-19(10-13-22)17-24(16-18(2)3)31(27,28)23-14-11-20-7-5-6-8-21(20)15-23/h5-15,18H,4,16-17H2,1-3H3 |
| InChIKey | FIDBJUONGCYHCI-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|