C24H23NO6S2 — CID 4137449
[3-[[furan-2-ylmethyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4137449) has the molecular formula C24H23NO6S2 and a molecular weight of 485.58 g/mol. Its IUPAC name is [3-[[furan-2-ylmethyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[[furan-2-ylmethyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4137449 |
| Molecular Formula | C24H23NO6S2 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | [3-[[furan-2-ylmethyl(naphthalen-2-ylsulfonyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CN(Cc2ccco2)S(=O)(=O)c2ccc3ccccc3c2)c1 |
| InChI | InChI=1S/C24H23NO6S2/c1-2-32(26,27)31-22-10-5-7-19(15-22)17-25(18-23-11-6-14-30-23)33(28,29)24-13-12-20-8-3-4-9-21(20)16-24/h3-16H,2,17-18H2,1H3 |
| InChIKey | ZEMBRVMMMVGNTG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|