C14H17NO4S — CID 3545443
[3-[(furan-2-ylmethylamino)methyl]phenyl] ethanesulfonate (PubChem CID 3545443) has the molecular formula C14H17NO4S and a molecular weight of 295.36 g/mol. Its IUPAC name is [3-[(furan-2-ylmethylamino)methyl]phenyl] ethanesulfonate.
| Compound Name | [3-[(furan-2-ylmethylamino)methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 3545443 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | [3-[(furan-2-ylmethylamino)methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1cccc(CNCc2ccco2)c1 |
| InChI | InChI=1S/C14H17NO4S/c1-2-20(16,17)19-13-6-3-5-12(9-13)10-15-11-14-7-4-8-18-14/h3-9,15H,2,10-11H2,1H3 |
| InChIKey | OOWZNZIAEWTHAS-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|