C18H23NO6S2 — CID 4210374
[4-[[benzenesulfonyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 4210374) has the molecular formula C18H23NO6S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is [4-[[benzenesulfonyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[benzenesulfonyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 4210374 |
| Molecular Formula | C18H23NO6S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | [4-[[benzenesulfonyl(2-methoxyethyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CN(CCOC)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H23NO6S2/c1-3-26(20,21)25-17-11-9-16(10-12-17)15-19(13-14-24-2)27(22,23)18-7-5-4-6-8-18/h4-12H,3,13-15H2,1-2H3 |
| InChIKey | BSTHEYZRIQUKFD-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|