C19H25NO8S2 — CID 3425257
[2-methoxy-5-[[2-methoxyethyl-(4-methoxyphenyl)sulfonylamino]methyl]phenyl] methanesulfonate (PubChem CID 3425257) has the molecular formula C19H25NO8S2 and a molecular weight of 459.54 g/mol. Its IUPAC name is [2-methoxy-5-[[2-methoxyethyl-(4-methoxyphenyl)sulfonylamino]methyl]phenyl] methanesulfonate.
| Compound Name | [2-methoxy-5-[[2-methoxyethyl-(4-methoxyphenyl)sulfonylamino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 3425257 |
| Molecular Formula | C19H25NO8S2 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | [2-methoxy-5-[[2-methoxyethyl-(4-methoxyphenyl)sulfonylamino]methyl]phenyl] methanesulfonate |
| SMILES | COCCN(Cc1ccc(OC)c(OS(C)(=O)=O)c1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H25NO8S2/c1-25-12-11-20(30(23,24)17-8-6-16(26-2)7-9-17)14-15-5-10-18(27-3)19(13-15)28-29(4,21)22/h5-10,13H,11-12,14H2,1-4H3 |
| InChIKey | KNCNXEULKFJFBD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|