C16H21NO5S — CID 3552331
4-methoxy-N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide (PubChem CID 3552331) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 4-methoxy-N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 3552331 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 4-methoxy-N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]benzenesulfonamide |
| SMILES | COCCN(Cc1ccc(C)o1)S(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C16H21NO5S/c1-13-4-5-15(22-13)12-17(10-11-20-2)23(18,19)16-8-6-14(21-3)7-9-16/h4-9H,10-12H2,1-3H3 |
| InChIKey | PNXAXZJIQXDRAX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |