C19H21NO4S — CID 42773342
N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]naphthalene-2-sulfonamide (PubChem CID 42773342) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]naphthalene-2-sulfonamide.
| Compound Name | N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 42773342 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | N-(2-methoxyethyl)-N-[(5-methylfuran-2-yl)methyl]naphthalene-2-sulfonamide |
| SMILES | COCCN(Cc1ccc(C)o1)S(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H21NO4S/c1-15-7-9-18(24-15)14-20(11-12-23-2)25(21,22)19-10-8-16-5-3-4-6-17(16)13-19/h3-10,13H,11-12,14H2,1-2H3 |
| InChIKey | PBOBQHVGDKLWSC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |