C20H20ClNO5S — CID 18285388
N-[2-(3-chlorophenoxy)ethyl]-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide (PubChem CID 18285388) has the molecular formula C20H20ClNO5S and a molecular weight of 421.90 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 18285388 |
| Molecular Formula | C20H20ClNO5S |
| Molecular Weight | 421.90 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-N-(furan-2-ylmethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(CCOc2cccc(Cl)c2)Cc2ccco2)cc1 |
| InChI | InChI=1S/C20H20ClNO5S/c1-25-17-7-9-20(10-8-17)28(23,24)22(15-19-6-3-12-26-19)11-13-27-18-5-2-4-16(21)14-18/h2-10,12,14H,11,13,15H2,1H3 |
| InChIKey | MRZQAOBYTHEQHH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 68.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.90 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |