C15H16ClNO5S — CID 50894510
4-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]butanoic acid (PubChem CID 50894510) has the molecular formula C15H16ClNO5S and a molecular weight of 357.81 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]butanoic acid.
| Compound Name | 4-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 50894510 |
| Molecular Formula | C15H16ClNO5S |
| Molecular Weight | 357.81 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]butanoic acid |
| SMILES | O=C(O)CCCN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H16ClNO5S/c16-12-5-7-14(8-6-12)23(20,21)17(9-1-4-15(18)19)11-13-3-2-10-22-13/h2-3,5-8,10H,1,4,9,11H2,(H,18,19) |
| InChIKey | JKZHKPHGXUHPOA-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.81 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |