C13H13ClN2O4S — CID 50894441
2-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide (PubChem CID 50894441) has the molecular formula C13H13ClN2O4S and a molecular weight of 328.78 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide.
| Compound Name | 2-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 50894441 |
| Molecular Formula | C13H13ClN2O4S |
| Molecular Weight | 328.78 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetamide |
| SMILES | NC(=O)CN(Cc1ccco1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H13ClN2O4S/c14-10-3-5-12(6-4-10)21(18,19)16(9-13(15)17)8-11-2-1-7-20-11/h1-7H,8-9H2,(H2,15,17) |
| InChIKey | JHGVYGYQDNOGNI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.78 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |