C14H14FNO5S — CID 50894270
methyl 2-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetate (PubChem CID 50894270) has the molecular formula C14H14FNO5S and a molecular weight of 327.33 g/mol. Its IUPAC name is methyl 2-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetate.
| Compound Name | methyl 2-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetate |
|---|---|
| PubChem CID | 50894270 |
| Molecular Formula | C14H14FNO5S |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | methyl 2-[(4-fluorophenyl)sulfonyl-(furan-2-ylmethyl)amino]acetate |
| SMILES | COC(=O)CN(Cc1ccco1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H14FNO5S/c1-20-14(17)10-16(9-12-3-2-8-21-12)22(18,19)13-6-4-11(15)5-7-13/h2-8H,9-10H2,1H3 |
| InChIKey | BTSFDJUHCJVQKO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |