C13H13NO5S — CID 716043
2-[benzenesulfonyl(furan-2-ylmethyl)amino]acetic acid (PubChem CID 716043) has the molecular formula C13H13NO5S and a molecular weight of 295.32 g/mol. Its IUPAC name is 2-[benzenesulfonyl(furan-2-ylmethyl)amino]acetic acid.
| Compound Name | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 716043 |
| Molecular Formula | C13H13NO5S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 2-[benzenesulfonyl(furan-2-ylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccco1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H13NO5S/c15-13(16)10-14(9-11-5-4-8-19-11)20(17,18)12-6-2-1-3-7-12/h1-8H,9-10H2,(H,15,16) |
| InChIKey | CJROUZFQNICTKL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |