C13H12N2O7S — CID 50894682
2-[furan-2-ylmethyl-(3-nitrophenyl)sulfonylamino]acetic acid (PubChem CID 50894682) has the molecular formula C13H12N2O7S and a molecular weight of 340.31 g/mol. Its IUPAC name is 2-[furan-2-ylmethyl-(3-nitrophenyl)sulfonylamino]acetic acid.
| Compound Name | 2-[furan-2-ylmethyl-(3-nitrophenyl)sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 50894682 |
| Molecular Formula | C13H12N2O7S |
| Molecular Weight | 340.31 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | 2-[furan-2-ylmethyl-(3-nitrophenyl)sulfonylamino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccco1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O7S/c16-13(17)9-14(8-11-4-2-6-22-11)23(20,21)12-5-1-3-10(7-12)15(18)19/h1-7H,8-9H2,(H,16,17) |
| InChIKey | CHAVLRWVPJYKTI-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 130.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.31 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|