C14H10Cl2N2O6S — CID 50892507
2-(3,5-dichloro-N-(3-nitrophenyl)sulfonylanilino)acetic acid (PubChem CID 50892507) has the molecular formula C14H10Cl2N2O6S and a molecular weight of 405.22 g/mol. Its IUPAC name is 2-(3,5-dichloro-N-(3-nitrophenyl)sulfonylanilino)acetic acid.
| Compound Name | 2-(3,5-dichloro-N-(3-nitrophenyl)sulfonylanilino)acetic acid |
|---|---|
| PubChem CID | 50892507 |
| Molecular Formula | C14H10Cl2N2O6S |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 403.96 |
| IUPAC Name | 2-(3,5-dichloro-N-(3-nitrophenyl)sulfonylanilino)acetic acid |
| SMILES | O=C(O)CN(c1cc(Cl)cc(Cl)c1)S(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H10Cl2N2O6S/c15-9-4-10(16)6-12(5-9)17(8-14(19)20)25(23,24)13-3-1-2-11(7-13)18(21)22/h1-7H,8H2,(H,19,20) |
| InChIKey | VETNENWZGKLMAI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|